C26H24ClN3O3S — CID 22589954
11-acetyl-4-(2-chlorophenyl)-6-[(2,5-dimethylphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione (PubChem CID 22589954) has the molecular formula C26H24ClN3O3S and a molecular weight of 494.02 g/mol. Its IUPAC name is 11-acetyl-4-(2-chlorophenyl)-6-[(2,5-dimethylphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione.
| Compound Name | 11-acetyl-4-(2-chlorophenyl)-6-[(2,5-dimethylphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione |
|---|---|
| PubChem CID | 22589954 |
| Molecular Formula | C26H24ClN3O3S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 11-acetyl-4-(2-chlorophenyl)-6-[(2,5-dimethylphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione |
| SMILES | CC(=O)N1CCc2c(sc3c2c(=O)n(-c2ccccc2Cl)c(=O)n3Cc2cc(C)ccc2C)C1 |
| InChI | InChI=1S/C26H24ClN3O3S/c1-15-8-9-16(2)18(12-15)13-29-25-23(19-10-11-28(17(3)31)14-22(19)34-25)24(32)30(26(29)33)21-7-5-4-6-20(21)27/h4-9,12H,10-11,13-14H2,1-3H3 |
| InChIKey | VEKGLUXAMIDCHS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |