C23H17FN4O3S2 — CID 22590026
12-(4-fluorophenyl)-N-(2-methoxyphenyl)-4-methyl-2-oxo-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraene-5-carboxamide (PubChem CID 22590026) has the molecular formula C23H17FN4O3S2 and a molecular weight of 480.55 g/mol. Its IUPAC name is 12-(4-fluorophenyl)-N-(2-methoxyphenyl)-4-methyl-2-oxo-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraene-5-carboxamide.
| Compound Name | 12-(4-fluorophenyl)-N-(2-methoxyphenyl)-4-methyl-2-oxo-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 22590026 |
| Molecular Formula | C23H17FN4O3S2 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 12-(4-fluorophenyl)-N-(2-methoxyphenyl)-4-methyl-2-oxo-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraene-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1sc2nc3n(c(=O)c2c1C)N=C(c1ccc(F)cc1)CS3 |
| InChI | InChI=1S/C23H17FN4O3S2/c1-12-18-21(33-19(12)20(29)25-15-5-3-4-6-17(15)31-2)26-23-28(22(18)30)27-16(11-32-23)13-7-9-14(24)10-8-13/h3-10H,11H2,1-2H3,(H,25,29) |
| InChIKey | YNZRVFAYTNLPRE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |