About 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine
1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 22590066) has the molecular formula C12H19N5
and a molecular weight of 233.32 g/mol. Its IUPAC name is 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 22590066 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CCCN(CCC)c1ncnc2c1cnn2C |
| InChI | InChI=1S/C12H19N5/c1-4-6-17(7-5-2)12-10-8-15-16(3)11(10)13-9-14-12/h8-9H,4-7H2,1-3H3 |
| InChIKey | VVYVZUXBMFJEKI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine (CID 22590066) is 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine is CCCN(CCC)c1ncnc2c1cnn2C.
What is the InChIKey of 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is VVYVZUXBMFJEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5/c1-4-6-17(7-5-2)12-10-8-15-16(3)11(10)13-9-14-12/h8-9H,4-7H2,1-3H3.
What are the key properties of 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine?
1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 233.32 g/mol, XLogP of 1.99, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 22590066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).