About methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate
methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate (PubChem CID 22590075) has the molecular formula C13H17N5O2
and a molecular weight of 275.31 g/mol. Its IUPAC name is methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate |
| PubChem CID | 22590075 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc3c2cnn3C)CC1 |
| InChI | InChI=1S/C13H17N5O2/c1-17-11-10(7-16-17)12(15-8-14-11)18-5-3-9(4-6-18)13(19)20-2/h7-9H,3-6H2,1-2H3 |
| InChIKey | ZWGCDFBTJDDTDH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate?
The IUPAC name of methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate (CID 22590075) is methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate?
The canonical SMILES for methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate is COC(=O)C1CCN(c2ncnc3c2cnn3C)CC1.
What is the InChIKey of methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate?
The InChIKey is ZWGCDFBTJDDTDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O2/c1-17-11-10(7-16-17)12(15-8-14-11)18-5-3-9(4-6-18)13(19)20-2/h7-9H,3-6H2,1-2H3.
What are the key properties of methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate?
methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate has a molecular weight of 275.31 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carboxylate is sourced from PubChem (CID 22590075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).