About (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate
(2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate (PubChem CID 22590221) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate |
| PubChem CID | 22590221 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate |
| SMILES | CC(CC(=O)OOOC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C13H26O4/c1-10(9-12(2,3)4)8-11(14)15-17-16-13(5,6)7/h10H,8-9H2,1-7H3 |
| InChIKey | HCXVPNKIBYLBIT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate?
The IUPAC name of (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate (CID 22590221) is (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate.
What is the SMILES notation for (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate?
The canonical SMILES for (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate is CC(CC(=O)OOOC(C)(C)C)CC(C)(C)C.
What is the InChIKey of (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate?
The InChIKey is HCXVPNKIBYLBIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O4/c1-10(9-12(2,3)4)8-11(14)15-17-16-13(5,6)7/h10H,8-9H2,1-7H3.
What are the key properties of (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate?
(2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate has a molecular weight of 246.35 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxy 3,5,5-trimethylhexaneperoxoate is sourced from PubChem (CID 22590221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).