About acenaphthylene-5-thiol
acenaphthylene-5-thiol (PubChem CID 22590265) has the molecular formula C12H8S
and a molecular weight of 184.26 g/mol. Its IUPAC name is acenaphthylene-5-thiol.
Molecular Properties
| Compound Name | acenaphthylene-5-thiol |
| PubChem CID | 22590265 |
| Molecular Formula | C12H8S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | acenaphthylene-5-thiol |
| SMILES | Sc1ccc2c3c(cccc13)C=C2 |
| InChI | InChI=1S/C12H8S/c13-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7,13H |
| InChIKey | JNOPALMOIOHKIT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze acenaphthylene-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acenaphthylene-5-thiol?
The IUPAC name of acenaphthylene-5-thiol (CID 22590265) is acenaphthylene-5-thiol.
What is the SMILES notation for acenaphthylene-5-thiol?
The canonical SMILES for acenaphthylene-5-thiol is Sc1ccc2c3c(cccc13)C=C2.
What is the InChIKey of acenaphthylene-5-thiol?
The InChIKey is JNOPALMOIOHKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S/c13-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7,13H.
What are the key properties of acenaphthylene-5-thiol?
acenaphthylene-5-thiol has a molecular weight of 184.26 g/mol, XLogP of 3.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acenaphthylene-5-thiol is sourced from PubChem (CID 22590265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).