C13H23N4O3+ — CID 22590391
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-(2-methylpropyl)morpholin-4-ium (PubChem CID 22590391) has the molecular formula C13H23N4O3+ and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-(2-methylpropyl)morpholin-4-ium.
| Compound Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-(2-methylpropyl)morpholin-4-ium |
|---|---|
| PubChem CID | 22590391 |
| Molecular Formula | C13H23N4O3+ |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-(2-methylpropyl)morpholin-4-ium |
| SMILES | COc1nc(OC)nc([N+]2(CC(C)C)CCOCC2)n1 |
| InChI | InChI=1S/C13H23N4O3/c1-10(2)9-17(5-7-20-8-6-17)11-14-12(18-3)16-13(15-11)19-4/h10H,5-9H2,1-4H3/q+1 |
| InChIKey | IRTYOLYHLMRNNM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|