C15H27ClN4O3 — CID 22590463
4-(4,6-diethoxy-1,3,5-triazin-2-yl)-4-(2-methylpropyl)morpholin-4-ium chloride (PubChem CID 22590463) has the molecular formula C15H27ClN4O3 and a molecular weight of 346.86 g/mol. Its IUPAC name is 4-(4,6-diethoxy-1,3,5-triazin-2-yl)-4-(2-methylpropyl)morpholin-4-ium chloride.
| Compound Name | 4-(4,6-diethoxy-1,3,5-triazin-2-yl)-4-(2-methylpropyl)morpholin-4-ium chloride |
|---|---|
| PubChem CID | 22590463 |
| Molecular Formula | C15H27ClN4O3 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-(4,6-diethoxy-1,3,5-triazin-2-yl)-4-(2-methylpropyl)morpholin-4-ium chloride |
| SMILES | CCOc1nc(OCC)nc([N+]2(CC(C)C)CCOCC2)n1.[Cl-] |
| InChI | InChI=1S/C15H27N4O3.ClH/c1-5-21-14-16-13(17-15(18-14)22-6-2)19(11-12(3)4)7-9-20-10-8-19;/h12H,5-11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | KZWSXCVXGXPWJF-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|