About adamantane;N-methylidenehydroxylamine
adamantane;N-methylidenehydroxylamine (PubChem CID 22590623) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is adamantane;N-methylidenehydroxylamine.
Molecular Properties
| Compound Name | adamantane;N-methylidenehydroxylamine |
| PubChem CID | 22590623 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | adamantane;N-methylidenehydroxylamine |
| SMILES | C1C2CC3CC1CC(C2)C3.C=NO |
| InChI | InChI=1S/C10H16.CH3NO/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-3/h7-10H,1-6H2;3H,1H2 |
| InChIKey | QQPQBZAXZDLFAF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze adamantane;N-methylidenehydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;N-methylidenehydroxylamine?
The IUPAC name of adamantane;N-methylidenehydroxylamine (CID 22590623) is adamantane;N-methylidenehydroxylamine.
What is the SMILES notation for adamantane;N-methylidenehydroxylamine?
The canonical SMILES for adamantane;N-methylidenehydroxylamine is C1C2CC3CC1CC(C2)C3.C=NO.
What is the InChIKey of adamantane;N-methylidenehydroxylamine?
The InChIKey is QQPQBZAXZDLFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.CH3NO/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-3/h7-10H,1-6H2;3H,1H2.
What are the key properties of adamantane;N-methylidenehydroxylamine?
adamantane;N-methylidenehydroxylamine has a molecular weight of 181.28 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;N-methylidenehydroxylamine is sourced from PubChem (CID 22590623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).