C21H23F3O3S — CID 22592611
(5,5,8,8-tetramethyl-3-phenyl-6,7-dihydronaphthalen-1-yl) trifluoromethanesulfonate (PubChem CID 22592611) has the molecular formula C21H23F3O3S and a molecular weight of 412.47 g/mol. Its IUPAC name is (5,5,8,8-tetramethyl-3-phenyl-6,7-dihydronaphthalen-1-yl) trifluoromethanesulfonate.
| Compound Name | (5,5,8,8-tetramethyl-3-phenyl-6,7-dihydronaphthalen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22592611 |
| Molecular Formula | C21H23F3O3S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (5,5,8,8-tetramethyl-3-phenyl-6,7-dihydronaphthalen-1-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)CCC(C)(C)c2c(OS(=O)(=O)C(F)(F)F)cc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C21H23F3O3S/c1-19(2)10-11-20(3,4)18-16(19)12-15(14-8-6-5-7-9-14)13-17(18)27-28(25,26)21(22,23)24/h5-9,12-13H,10-11H2,1-4H3 |
| InChIKey | SFIOQYHUMQNPQZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|