C20H24O — CID 22592640
5,5,8,8-tetramethyl-3-phenyl-6,7-dihydronaphthalen-1-ol (PubChem CID 22592640) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 5,5,8,8-tetramethyl-3-phenyl-6,7-dihydronaphthalen-1-ol.
| Compound Name | 5,5,8,8-tetramethyl-3-phenyl-6,7-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 22592640 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5,5,8,8-tetramethyl-3-phenyl-6,7-dihydronaphthalen-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2c(O)cc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C20H24O/c1-19(2)10-11-20(3,4)18-16(19)12-15(13-17(18)21)14-8-6-5-7-9-14/h5-9,12-13,21H,10-11H2,1-4H3 |
| InChIKey | AGRRIFHKZLXFQO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |