About 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione
1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 22592723) has the molecular formula C9H10N2O5
and a molecular weight of 226.19 g/mol. Its IUPAC name is 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione.
Molecular Properties
| Compound Name | 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione |
| PubChem CID | 22592723 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CC2CO2)C(=O)N1CC1CO1 |
| InChI | InChI=1S/C9H10N2O5/c12-7-8(13)11(2-6-4-16-6)9(14)10(7)1-5-3-15-5/h5-6H,1-4H2 |
| InChIKey | YSLXMWUOWVNMCQ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 82.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione?
The IUPAC name of 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione (CID 22592723) is 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione.
What is the SMILES notation for 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione?
The canonical SMILES for 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione is O=C1C(=O)N(CC2CO2)C(=O)N1CC1CO1.
What is the InChIKey of 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione?
The InChIKey is YSLXMWUOWVNMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O5/c12-7-8(13)11(2-6-4-16-6)9(14)10(7)1-5-3-15-5/h5-6H,1-4H2.
What are the key properties of 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione?
1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione has a molecular weight of 226.19 g/mol, XLogP of -1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4,5-trione is sourced from PubChem (CID 22592723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).