About tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate
tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate (PubChem CID 22592868) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate |
| PubChem CID | 22592868 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1NCCSC1(C)C |
| InChI | InChI=1S/C11H21NO2S/c1-10(2,3)14-9(13)8-11(4,5)15-7-6-12-8/h8,12H,6-7H2,1-5H3 |
| InChIKey | IOMCQUXALFMUBK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate?
The IUPAC name of tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate (CID 22592868) is tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate.
What is the SMILES notation for tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate?
The canonical SMILES for tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate is CC(C)(C)OC(=O)C1NCCSC1(C)C.
What is the InChIKey of tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate?
The InChIKey is IOMCQUXALFMUBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2S/c1-10(2,3)14-9(13)8-11(4,5)15-7-6-12-8/h8,12H,6-7H2,1-5H3.
What are the key properties of tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate?
tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate has a molecular weight of 231.36 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,2-dimethylthiomorpholine-3-carboxylate is sourced from PubChem (CID 22592868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).