About prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate
prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate (PubChem CID 22592895) has the molecular formula C21H24N2O5S2
and a molecular weight of 448.57 g/mol. Its IUPAC name is prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate |
| PubChem CID | 22592895 |
| Molecular Formula | C21H24N2O5S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate |
| SMILES | C=CCOC(=O)C1N(S(=O)(=O)c2ccc(Oc3ccncc3)cc2)CCSC1(C)C |
| InChI | InChI=1S/C21H24N2O5S2/c1-4-14-27-20(24)19-21(2,3)29-15-13-23(19)30(25,26)18-7-5-16(6-8-18)28-17-9-11-22-12-10-17/h4-12,19H,1,13-15H2,2-3H3 |
| InChIKey | ZPXXQHNVNKDRSR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate?
The IUPAC name of prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate (CID 22592895) is prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate.
What is the SMILES notation for prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate?
The canonical SMILES for prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate is C=CCOC(=O)C1N(S(=O)(=O)c2ccc(Oc3ccncc3)cc2)CCSC1(C)C.
What is the InChIKey of prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate?
The InChIKey is ZPXXQHNVNKDRSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O5S2/c1-4-14-27-20(24)19-21(2,3)29-15-13-23(19)30(25,26)18-7-5-16(6-8-18)28-17-9-11-22-12-10-17/h4-12,19H,1,13-15H2,2-3H3.
What are the key properties of prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate?
prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate has a molecular weight of 448.57 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate is sourced from PubChem (CID 22592895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).