C8H6F10 — CID 22593150
1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-dimethylcyclohexane (PubChem CID 22593150) has the molecular formula C8H6F10 and a molecular weight of 292.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-dimethylcyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-dimethylcyclohexane |
|---|---|
| PubChem CID | 22593150 |
| Molecular Formula | C8H6F10 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-dimethylcyclohexane |
| SMILES | CC1(F)C(C)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H6F10/c1-3(9)4(2,10)6(13,14)8(17,18)7(15,16)5(3,11)12/h1-2H3 |
| InChIKey | LBBIUFZOTWLTKZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|