About 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one
3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one (PubChem CID 22593255) has the molecular formula C6H8O5
and a molecular weight of 160.12 g/mol. Its IUPAC name is 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one |
| PubChem CID | 22593255 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C(O)=COC(CO)C1O |
| InChI | InChI=1S/C6H8O5/c7-1-4-6(10)5(9)3(8)2-11-4/h2,4,6-8,10H,1H2 |
| InChIKey | CLDKGBMTBWSEPC-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one?
The IUPAC name of 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one (CID 22593255) is 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one.
What is the SMILES notation for 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one?
The canonical SMILES for 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one is O=C1C(O)=COC(CO)C1O.
What is the InChIKey of 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one?
The InChIKey is CLDKGBMTBWSEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O5/c7-1-4-6(10)5(9)3(8)2-11-4/h2,4,6-8,10H,1H2.
What are the key properties of 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one?
3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one has a molecular weight of 160.12 g/mol, XLogP of -1.29, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one is sourced from PubChem (CID 22593255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).