About CID 22593281
CID 22593281 (PubChem CID 22593281) has the molecular formula C7H15O2Si
and a molecular weight of 159.28 g/mol.
Molecular Properties
| Compound Name | CID 22593281 |
| PubChem CID | 22593281 |
| Molecular Formula | C7H15O2Si |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | — |
| SMILES | CC(C)OC([Si])OC(C)C |
| InChI | InChI=1S/C7H15O2Si/c1-5(2)8-7(10)9-6(3)4/h5-7H,1-4H3 |
| InChIKey | VOZXSZFFKJAIID-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 22593281 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22593281?
The IUPAC name of CID 22593281 (CID 22593281) is not available.
What is the SMILES notation for CID 22593281?
The canonical SMILES for CID 22593281 is CC(C)OC([Si])OC(C)C.
What is the InChIKey of CID 22593281?
The InChIKey is VOZXSZFFKJAIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O2Si/c1-5(2)8-7(10)9-6(3)4/h5-7H,1-4H3.
What are the key properties of CID 22593281?
CID 22593281 has a molecular weight of 159.28 g/mol, XLogP of 1.29, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22593281 is sourced from PubChem (CID 22593281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).