C16H8F9IN2O7S — CID 22593412
bis(3-nitrophenyl)iodanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 22593412) has the molecular formula C16H8F9IN2O7S and a molecular weight of 670.20 g/mol. Its IUPAC name is bis(3-nitrophenyl)iodanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | bis(3-nitrophenyl)iodanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 22593412 |
| Molecular Formula | C16H8F9IN2O7S |
| Molecular Weight | 670.20 g/mol |
| Exact Mass | 669.90 |
| IUPAC Name | bis(3-nitrophenyl)iodanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=[N+]([O-])c1cccc([I+]c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C12H8IN2O4.C4HF9O3S/c16-14(17)11-5-1-3-9(7-11)13-10-4-2-6-12(8-10)15(18)19;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-8H;(H,14,15,16)/q+1;/p-1 |
| InChIKey | LMOYZFKCQSRGLA-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 143.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|