About 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one
5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one (PubChem CID 22594214) has the molecular formula C17H11F6NO2
and a molecular weight of 375.27 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one |
| PubChem CID | 22594214 |
| Molecular Formula | C17H11F6NO2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C17H11F6NO2/c18-16(19,20)11-3-9(4-12(6-11)17(21,22)23)8-26-13-1-2-14-10(5-13)7-24-15(14)25/h1-6H,7-8H2,(H,24,25) |
| InChIKey | UENKBLWQWIESKT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one (CID 22594214) is 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one is O=C1NCc2cc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc21.
What is the InChIKey of 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one?
The InChIKey is UENKBLWQWIESKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F6NO2/c18-16(19,20)11-3-9(4-12(6-11)17(21,22)23)8-26-13-1-2-14-10(5-13)7-24-15(14)25/h1-6H,7-8H2,(H,24,25).
What are the key properties of 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one?
5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one has a molecular weight of 375.27 g/mol, XLogP of 4.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 22594214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).