About 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide
2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide (PubChem CID 22594224) has the molecular formula C19H14F6N2O3
and a molecular weight of 432.32 g/mol. Its IUPAC name is 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide |
| PubChem CID | 22594224 |
| Molecular Formula | C19H14F6N2O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide |
| SMILES | NC(=O)CN1Cc2cc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2C1=O |
| InChI | InChI=1S/C19H14F6N2O3/c20-18(21,22)12-3-10(4-13(6-12)19(23,24)25)9-30-14-1-2-15-11(5-14)7-27(17(15)29)8-16(26)28/h1-6H,7-9H2,(H2,26,28) |
| InChIKey | PVPYPMGYJFFZGB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide?
The IUPAC name of 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide (CID 22594224) is 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide.
What is the SMILES notation for 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide?
The canonical SMILES for 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide is NC(=O)CN1Cc2cc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2C1=O.
What is the InChIKey of 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide?
The InChIKey is PVPYPMGYJFFZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F6N2O3/c20-18(21,22)12-3-10(4-13(6-12)19(23,24)25)9-30-14-1-2-15-11(5-14)7-27(17(15)29)8-16(26)28/h1-6H,7-9H2,(H2,26,28).
What are the key properties of 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide?
2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide has a molecular weight of 432.32 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]acetamide is sourced from PubChem (CID 22594224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).