C26H31N3O3 — CID 22594251
2-[7-[[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid (PubChem CID 22594251) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[7-[[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid.
| Compound Name | 2-[7-[[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid |
|---|---|
| PubChem CID | 22594251 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[7-[[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid |
| SMILES | O=C(O)CC1CC(CNC(=O)CCCc2ccc3c(n2)NCCC3)=CCc2ccccc21 |
| InChI | InChI=1S/C26H31N3O3/c30-24(9-3-7-22-13-12-20-6-4-14-27-26(20)29-22)28-17-18-10-11-19-5-1-2-8-23(19)21(15-18)16-25(31)32/h1-2,5,8,10,12-13,21H,3-4,6-7,9,11,14-17H2,(H,27,29)(H,28,30)(H,31,32) |
| InChIKey | XGZVUDGXURHWEC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|