C40H54N4O4 — CID 22595031
(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzotriazole-5-carboxylate (PubChem CID 22595031) has the molecular formula C40H54N4O4 and a molecular weight of 654.90 g/mol. Its IUPAC name is (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzotriazole-5-carboxylate.
| Compound Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 22595031 |
| Molecular Formula | C40H54N4O4 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzotriazole-5-carboxylate |
| SMILES | CON1C(C)(C)CC(OC(=O)c2ccc3nn(-c4cc(C(C)(C)CC(C)(C)C)cc(C(C)(C)c5ccccc5)c4O)nc3c2)CC1(C)C |
| InChI | InChI=1S/C40H54N4O4/c1-36(2,3)25-37(4,5)28-21-30(40(10,11)27-16-14-13-15-17-27)34(45)33(22-28)43-41-31-19-18-26(20-32(31)42-43)35(46)48-29-23-38(6,7)44(47-12)39(8,9)24-29/h13-22,29,45H,23-25H2,1-12H3 |
| InChIKey | FNMXESJAYCSGDM-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |