About 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one
1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one (PubChem CID 22595138) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one |
| PubChem CID | 22595138 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one |
| SMILES | CCCN1CCCC1=O.CCN1CCCC1=O |
| InChI | InChI=1S/C7H13NO.C6H11NO/c1-2-5-8-6-3-4-7(8)9;1-2-7-5-3-4-6(7)8/h2-6H2,1H3;2-5H2,1H3 |
| InChIKey | SSPSDHPOYVVQNH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one?
The IUPAC name of 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one (CID 22595138) is 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one.
What is the SMILES notation for 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one?
The canonical SMILES for 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one is CCCN1CCCC1=O.CCN1CCCC1=O.
What is the InChIKey of 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one?
The InChIKey is SSPSDHPOYVVQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C6H11NO/c1-2-5-8-6-3-4-7(8)9;1-2-7-5-3-4-6(7)8/h2-6H2,1H3;2-5H2,1H3.
What are the key properties of 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one?
1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one has a molecular weight of 240.35 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrolidin-2-one;1-propylpyrrolidin-2-one is sourced from PubChem (CID 22595138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).