About 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole
10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole (PubChem CID 22595906) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole.
Analyze 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole?
The IUPAC name of 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole (CID 22595906) is 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole.
What is the SMILES notation for 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole?
The canonical SMILES for 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole is CC1C2CC=CC=C2N2C=CN=CC12.
What is the InChIKey of 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole?
The InChIKey is BKZFMHRZRRKUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-9-10-4-2-3-5-11(10)14-7-6-13-8-12(9)14/h2-3,5-10,12H,4H2,1H3.
What are the key properties of 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole?
10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole has a molecular weight of 186.26 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-9,9a,10,10a-tetrahydropyrazino[1,2-a]indole is sourced from PubChem (CID 22595906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).