About beryllium bis(benzo[h]quinolin-10-olate)
beryllium bis(benzo[h]quinolin-10-olate) (PubChem CID 22596848) has the molecular formula C26H16BeN2O2
and a molecular weight of 397.44 g/mol. Its IUPAC name is beryllium bis(benzo[h]quinolin-10-olate).
Molecular Properties
| Compound Name | beryllium bis(benzo[h]quinolin-10-olate) |
| PubChem CID | 22596848 |
| Molecular Formula | C26H16BeN2O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | beryllium bis(benzo[h]quinolin-10-olate) |
| SMILES | [Be+2].[O-]c1cccc2ccc3cccnc3c12.[O-]c1cccc2ccc3cccnc3c12 |
| InChI | InChI=1S/2C13H9NO.Be/c2*15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h2*1-8,15H;/q;;+2/p-2 |
| InChIKey | GQVWHWAWLPCBHB-UHFFFAOYSA-L |
| XLogP | 4.54 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze beryllium bis(benzo[h]quinolin-10-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium bis(benzo[h]quinolin-10-olate)?
The IUPAC name of beryllium bis(benzo[h]quinolin-10-olate) (CID 22596848) is beryllium bis(benzo[h]quinolin-10-olate).
What is the SMILES notation for beryllium bis(benzo[h]quinolin-10-olate)?
The canonical SMILES for beryllium bis(benzo[h]quinolin-10-olate) is [Be+2].[O-]c1cccc2ccc3cccnc3c12.[O-]c1cccc2ccc3cccnc3c12.
What is the InChIKey of beryllium bis(benzo[h]quinolin-10-olate)?
The InChIKey is GQVWHWAWLPCBHB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H9NO.Be/c2*15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h2*1-8,15H;/q;;+2/p-2.
What are the key properties of beryllium bis(benzo[h]quinolin-10-olate)?
beryllium bis(benzo[h]quinolin-10-olate) has a molecular weight of 397.44 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium bis(benzo[h]quinolin-10-olate) is sourced from PubChem (CID 22596848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).