About N-propan-2-ylpropan-2-amine;dihydrofluoride
N-propan-2-ylpropan-2-amine;dihydrofluoride (PubChem CID 22597313) has the molecular formula C6H17F2N
and a molecular weight of 141.20 g/mol. Its IUPAC name is N-propan-2-ylpropan-2-amine;dihydrofluoride.
Molecular Properties
| Compound Name | N-propan-2-ylpropan-2-amine;dihydrofluoride |
| PubChem CID | 22597313 |
| Molecular Formula | C6H17F2N |
| Molecular Weight | 141.20 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | N-propan-2-ylpropan-2-amine;dihydrofluoride |
| SMILES | CC(C)NC(C)C.F.F |
| InChI | InChI=1S/C6H15N.2FH/c1-5(2)7-6(3)4;;/h5-7H,1-4H3;2*1H |
| InChIKey | DHBMDAIKHIWLTF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-propan-2-ylpropan-2-amine;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-ylpropan-2-amine;dihydrofluoride?
The IUPAC name of N-propan-2-ylpropan-2-amine;dihydrofluoride (CID 22597313) is N-propan-2-ylpropan-2-amine;dihydrofluoride.
What is the SMILES notation for N-propan-2-ylpropan-2-amine;dihydrofluoride?
The canonical SMILES for N-propan-2-ylpropan-2-amine;dihydrofluoride is CC(C)NC(C)C.F.F.
What is the InChIKey of N-propan-2-ylpropan-2-amine;dihydrofluoride?
The InChIKey is DHBMDAIKHIWLTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.2FH/c1-5(2)7-6(3)4;;/h5-7H,1-4H3;2*1H.
What are the key properties of N-propan-2-ylpropan-2-amine;dihydrofluoride?
N-propan-2-ylpropan-2-amine;dihydrofluoride has a molecular weight of 141.20 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-ylpropan-2-amine;dihydrofluoride is sourced from PubChem (CID 22597313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).