About 7-bromoquinoline-2,3-dione
7-bromoquinoline-2,3-dione (PubChem CID 22597669) has the molecular formula C9H4BrNO2
and a molecular weight of 238.04 g/mol. Its IUPAC name is 7-bromoquinoline-2,3-dione.
Molecular Properties
| Compound Name | 7-bromoquinoline-2,3-dione |
| PubChem CID | 22597669 |
| Molecular Formula | C9H4BrNO2 |
| Molecular Weight | 238.04 g/mol |
| Exact Mass | 236.94 |
| IUPAC Name | 7-bromoquinoline-2,3-dione |
| SMILES | O=C1C=c2ccc(Br)cc2=NC1=O |
| InChI | InChI=1S/C9H4BrNO2/c10-6-2-1-5-3-8(12)9(13)11-7(5)4-6/h1-4H |
| InChIKey | KBSBZNKQTOLGQX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.04 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-bromoquinoline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromoquinoline-2,3-dione?
The IUPAC name of 7-bromoquinoline-2,3-dione (CID 22597669) is 7-bromoquinoline-2,3-dione.
What is the SMILES notation for 7-bromoquinoline-2,3-dione?
The canonical SMILES for 7-bromoquinoline-2,3-dione is O=C1C=c2ccc(Br)cc2=NC1=O.
What is the InChIKey of 7-bromoquinoline-2,3-dione?
The InChIKey is KBSBZNKQTOLGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrNO2/c10-6-2-1-5-3-8(12)9(13)11-7(5)4-6/h1-4H.
What are the key properties of 7-bromoquinoline-2,3-dione?
7-bromoquinoline-2,3-dione has a molecular weight of 238.04 g/mol, XLogP of -0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromoquinoline-2,3-dione is sourced from PubChem (CID 22597669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).