C19H22N2O2 — CID 22597840
4-ethoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide (PubChem CID 22597840) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-ethoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide.
| Compound Name | 4-ethoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 22597840 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-ethoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc3c(c2)CN(C)CC3)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-3-23-18-8-5-15(6-9-18)19(22)20-17-7-4-14-10-11-21(2)13-16(14)12-17/h4-9,12H,3,10-11,13H2,1-2H3,(H,20,22) |
| InChIKey | XJYGKTKHKCKQFV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |