About azane;1,2,3,4-tetrahydronaphthalene
azane;1,2,3,4-tetrahydronaphthalene (PubChem CID 22598116) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is azane;1,2,3,4-tetrahydronaphthalene.
Molecular Properties
| Compound Name | azane;1,2,3,4-tetrahydronaphthalene |
| PubChem CID | 22598116 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | azane;1,2,3,4-tetrahydronaphthalene |
| SMILES | N.N.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H12.2H3N/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-2,5-6H,3-4,7-8H2;2*1H3 |
| InChIKey | VLSCZKQSPXJNOJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2,3,4-tetrahydronaphthalene?
The IUPAC name of azane;1,2,3,4-tetrahydronaphthalene (CID 22598116) is azane;1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for azane;1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for azane;1,2,3,4-tetrahydronaphthalene is N.N.c1ccc2c(c1)CCCC2.
What is the InChIKey of azane;1,2,3,4-tetrahydronaphthalene?
The InChIKey is VLSCZKQSPXJNOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.2H3N/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-2,5-6H,3-4,7-8H2;2*1H3.
What are the key properties of azane;1,2,3,4-tetrahydronaphthalene?
azane;1,2,3,4-tetrahydronaphthalene has a molecular weight of 166.27 g/mol, XLogP of 2.89, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 22598116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).