C41H62ClN7O2 — CID 22598274
2-N,4-N-dibutyl-6-chloro-2-N,4-N-bis(2,2,6,6-tetramethyl-1-phenoxypiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 22598274) has the molecular formula C41H62ClN7O2 and a molecular weight of 720.45 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-6-chloro-2-N,4-N-bis(2,2,6,6-tetramethyl-1-phenoxypiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibutyl-6-chloro-2-N,4-N-bis(2,2,6,6-tetramethyl-1-phenoxypiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22598274 |
| Molecular Formula | C41H62ClN7O2 |
| Molecular Weight | 720.45 g/mol |
| Exact Mass | 719.47 |
| IUPAC Name | 2-N,4-N-dibutyl-6-chloro-2-N,4-N-bis(2,2,6,6-tetramethyl-1-phenoxypiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCN(c1nc(Cl)nc(N(CCCC)C2CC(C)(C)N(Oc3ccccc3)C(C)(C)C2)n1)C1CC(C)(C)N(Oc2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C41H62ClN7O2/c1-11-13-25-46(31-27-38(3,4)48(39(5,6)28-31)50-33-21-17-15-18-22-33)36-43-35(42)44-37(45-36)47(26-14-12-2)32-29-40(7,8)49(41(9,10)30-32)51-34-23-19-16-20-24-34/h15-24,31-32H,11-14,25-30H2,1-10H3 |
| InChIKey | LTXYIDHDKHMDCR-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.45 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |