C20H17N5O6 — CID 22598342
4-[[5-(1,3,5,8-tetraoxo-2,4,7-triazaspiro[5.5]undecan-7-yl)-2-pyridinyl]oxy]benzamide (PubChem CID 22598342) has the molecular formula C20H17N5O6 and a molecular weight of 423.39 g/mol. Its IUPAC name is 4-[[5-(1,3,5,8-tetraoxo-2,4,7-triazaspiro[5.5]undecan-7-yl)-2-pyridinyl]oxy]benzamide.
| Compound Name | 4-[[5-(1,3,5,8-tetraoxo-2,4,7-triazaspiro[5.5]undecan-7-yl)-2-pyridinyl]oxy]benzamide |
|---|---|
| PubChem CID | 22598342 |
| Molecular Formula | C20H17N5O6 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-[[5-(1,3,5,8-tetraoxo-2,4,7-triazaspiro[5.5]undecan-7-yl)-2-pyridinyl]oxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(N3C(=O)CCCC34C(=O)NC(=O)NC4=O)cn2)cc1 |
| InChI | InChI=1S/C20H17N5O6/c21-16(27)11-3-6-13(7-4-11)31-14-8-5-12(10-22-14)25-15(26)2-1-9-20(25)17(28)23-19(30)24-18(20)29/h3-8,10H,1-2,9H2,(H2,21,27)(H2,23,24,28,29,30) |
| InChIKey | FIRGOMBDFXHEAZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 160.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|