About benzene-1,3,5-trisulfinate
benzene-1,3,5-trisulfinate (PubChem CID 22598892) has the molecular formula C6H3O6S3-3
and a molecular weight of 267.28 g/mol. Its IUPAC name is benzene-1,3,5-trisulfinate.
Molecular Properties
| Compound Name | benzene-1,3,5-trisulfinate |
| PubChem CID | 22598892 |
| Molecular Formula | C6H3O6S3-3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 266.91 |
| IUPAC Name | benzene-1,3,5-trisulfinate |
| SMILES | O=S([O-])c1cc(S(=O)[O-])cc(S(=O)[O-])c1 |
| InChI | InChI=1S/C6H6O6S3/c7-13(8)4-1-5(14(9)10)3-6(2-4)15(11)12/h1-3H,(H,7,8)(H,9,10)(H,11,12)/p-3 |
| InChIKey | KGGIOPJIBSPEIJ-UHFFFAOYSA-K |
| XLogP | -0.60 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3,5-trisulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3,5-trisulfinate?
The IUPAC name of benzene-1,3,5-trisulfinate (CID 22598892) is benzene-1,3,5-trisulfinate.
What is the SMILES notation for benzene-1,3,5-trisulfinate?
The canonical SMILES for benzene-1,3,5-trisulfinate is O=S([O-])c1cc(S(=O)[O-])cc(S(=O)[O-])c1.
What is the InChIKey of benzene-1,3,5-trisulfinate?
The InChIKey is KGGIOPJIBSPEIJ-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H6O6S3/c7-13(8)4-1-5(14(9)10)3-6(2-4)15(11)12/h1-3H,(H,7,8)(H,9,10)(H,11,12)/p-3.
What are the key properties of benzene-1,3,5-trisulfinate?
benzene-1,3,5-trisulfinate has a molecular weight of 267.28 g/mol, XLogP of -0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3,5-trisulfinate is sourced from PubChem (CID 22598892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).