About naphthalene-1,2,3-trisulfonyl chloride
naphthalene-1,2,3-trisulfonyl chloride (PubChem CID 22598894) has the molecular formula C10H5Cl3O6S3
and a molecular weight of 423.70 g/mol. Its IUPAC name is naphthalene-1,2,3-trisulfonyl chloride.
Molecular Properties
| Compound Name | naphthalene-1,2,3-trisulfonyl chloride |
| PubChem CID | 22598894 |
| Molecular Formula | C10H5Cl3O6S3 |
| Molecular Weight | 423.70 g/mol |
| Exact Mass | 421.83 |
| IUPAC Name | naphthalene-1,2,3-trisulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc2ccccc2c(S(=O)(=O)Cl)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H5Cl3O6S3/c11-20(14,15)8-5-6-3-1-2-4-7(6)9(21(12,16)17)10(8)22(13,18)19/h1-5H |
| InChIKey | LVDBKHCYVASMLO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze naphthalene-1,2,3-trisulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,2,3-trisulfonyl chloride?
The IUPAC name of naphthalene-1,2,3-trisulfonyl chloride (CID 22598894) is naphthalene-1,2,3-trisulfonyl chloride.
What is the SMILES notation for naphthalene-1,2,3-trisulfonyl chloride?
The canonical SMILES for naphthalene-1,2,3-trisulfonyl chloride is O=S(=O)(Cl)c1cc2ccccc2c(S(=O)(=O)Cl)c1S(=O)(=O)Cl.
What is the InChIKey of naphthalene-1,2,3-trisulfonyl chloride?
The InChIKey is LVDBKHCYVASMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl3O6S3/c11-20(14,15)8-5-6-3-1-2-4-7(6)9(21(12,16)17)10(8)22(13,18)19/h1-5H.
What are the key properties of naphthalene-1,2,3-trisulfonyl chloride?
naphthalene-1,2,3-trisulfonyl chloride has a molecular weight of 423.70 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,2,3-trisulfonyl chloride is sourced from PubChem (CID 22598894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).