About 4-(bromomethyl)benzoic acid
4-(bromomethyl)benzoic acid (PubChem CID 22599) has the molecular formula C8H7BrO2
and a molecular weight of 215.05 g/mol. Its IUPAC name is 4-(bromomethyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(bromomethyl)benzoic acid |
| PubChem CID | 22599 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | 4-(bromomethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C8H7BrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | CQQSQBRPAJSTFB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)benzoic acid?
The IUPAC name of 4-(bromomethyl)benzoic acid (CID 22599) is 4-(bromomethyl)benzoic acid.
What is the SMILES notation for 4-(bromomethyl)benzoic acid?
The canonical SMILES for 4-(bromomethyl)benzoic acid is O=C(O)c1ccc(CBr)cc1.
What is the InChIKey of 4-(bromomethyl)benzoic acid?
The InChIKey is CQQSQBRPAJSTFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2,(H,10,11).
What are the key properties of 4-(bromomethyl)benzoic acid?
4-(bromomethyl)benzoic acid has a molecular weight of 215.05 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)benzoic acid is sourced from PubChem (CID 22599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).