C29H32N4O3S — CID 22599464
ethyl 2-(1,3-benzothiazol-2-ylamino)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoate (PubChem CID 22599464) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is ethyl 2-(1,3-benzothiazol-2-ylamino)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoate.
| Compound Name | ethyl 2-(1,3-benzothiazol-2-ylamino)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22599464 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | ethyl 2-(1,3-benzothiazol-2-ylamino)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCCc2ccc3c(n2)NCCC3)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C29H32N4O3S/c1-2-35-28(34)25(33-29-32-24-9-3-4-10-26(24)37-29)19-20-11-15-23(16-12-20)36-18-6-8-22-14-13-21-7-5-17-30-27(21)31-22/h3-4,9-16,25H,2,5-8,17-19H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | LTQGDLAZGBIFQX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|