About 4-but-2-ynoxy-5,6-dichloropyrimidine
4-but-2-ynoxy-5,6-dichloropyrimidine (PubChem CID 22599751) has the molecular formula C8H6Cl2N2O
and a molecular weight of 217.05 g/mol. Its IUPAC name is 4-but-2-ynoxy-5,6-dichloropyrimidine.
Molecular Properties
| Compound Name | 4-but-2-ynoxy-5,6-dichloropyrimidine |
| PubChem CID | 22599751 |
| Molecular Formula | C8H6Cl2N2O |
| Molecular Weight | 217.05 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | 4-but-2-ynoxy-5,6-dichloropyrimidine |
| SMILES | CC#CCOc1ncnc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2N2O/c1-2-3-4-13-8-6(9)7(10)11-5-12-8/h5H,4H2,1H3 |
| InChIKey | BRQRPDTXVXDXAZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.05 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-2-ynoxy-5,6-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-2-ynoxy-5,6-dichloropyrimidine?
The IUPAC name of 4-but-2-ynoxy-5,6-dichloropyrimidine (CID 22599751) is 4-but-2-ynoxy-5,6-dichloropyrimidine.
What is the SMILES notation for 4-but-2-ynoxy-5,6-dichloropyrimidine?
The canonical SMILES for 4-but-2-ynoxy-5,6-dichloropyrimidine is CC#CCOc1ncnc(Cl)c1Cl.
What is the InChIKey of 4-but-2-ynoxy-5,6-dichloropyrimidine?
The InChIKey is BRQRPDTXVXDXAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2O/c1-2-3-4-13-8-6(9)7(10)11-5-12-8/h5H,4H2,1H3.
What are the key properties of 4-but-2-ynoxy-5,6-dichloropyrimidine?
4-but-2-ynoxy-5,6-dichloropyrimidine has a molecular weight of 217.05 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-ynoxy-5,6-dichloropyrimidine is sourced from PubChem (CID 22599751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).