C8H7F5 — CID 22599763
1-(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,3-diene (PubChem CID 22599763) has the molecular formula C8H7F5 and a molecular weight of 198.13 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,3-diene.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 22599763 |
| Molecular Formula | C8H7F5 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,3-diene |
| SMILES | FC(F)(F)C(F)(F)C1=CC=CCC1 |
| InChI | InChI=1S/C8H7F5/c9-7(10,8(11,12)13)6-4-2-1-3-5-6/h1-2,4H,3,5H2 |
| InChIKey | XRHMTKXTDMRDHA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|