About sec.-butoxysilane
sec.-butoxysilane (PubChem CID 22600299) has the molecular formula C4H9OSi
and a molecular weight of 101.20 g/mol.
Molecular Properties
| Compound Name | sec.-butoxysilane |
| PubChem CID | 22600299 |
| Molecular Formula | C4H9OSi |
| Molecular Weight | 101.20 g/mol |
| Exact Mass | 101.04 |
| IUPAC Name | — |
| SMILES | CCC(C)O[Si] |
| InChI | InChI=1S/C4H9OSi/c1-3-4(2)5-6/h4H,3H2,1-2H3 |
| InChIKey | UUFQRPZNNRRXBP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sec.-butoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sec.-butoxysilane?
The IUPAC name of sec.-butoxysilane (CID 22600299) is not available.
What is the SMILES notation for sec.-butoxysilane?
The canonical SMILES for sec.-butoxysilane is CCC(C)O[Si].
What is the InChIKey of sec.-butoxysilane?
The InChIKey is UUFQRPZNNRRXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9OSi/c1-3-4(2)5-6/h4H,3H2,1-2H3.
What are the key properties of sec.-butoxysilane?
sec.-butoxysilane has a molecular weight of 101.20 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sec.-butoxysilane is sourced from PubChem (CID 22600299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).