C12H21F7O2Si — CID 22600763
diethoxy-ethyl-(4,4,5,5,6,6,6-heptafluorohexyl)silane (PubChem CID 22600763) has the molecular formula C12H21F7O2Si and a molecular weight of 358.37 g/mol. Its IUPAC name is diethoxy-ethyl-(4,4,5,5,6,6,6-heptafluorohexyl)silane.
| Compound Name | diethoxy-ethyl-(4,4,5,5,6,6,6-heptafluorohexyl)silane |
|---|---|
| PubChem CID | 22600763 |
| Molecular Formula | C12H21F7O2Si |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | diethoxy-ethyl-(4,4,5,5,6,6,6-heptafluorohexyl)silane |
| SMILES | CCO[Si](CC)(CCCC(F)(F)C(F)(F)C(F)(F)F)OCC |
| InChI | InChI=1S/C12H21F7O2Si/c1-4-20-22(6-3,21-5-2)9-7-8-10(13,14)11(15,16)12(17,18)19/h4-9H2,1-3H3 |
| InChIKey | YTFUZVJXLGHLPQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|