C12H19F9O3Si — CID 22600765
triethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane (PubChem CID 22600765) has the molecular formula C12H19F9O3Si and a molecular weight of 410.35 g/mol. Its IUPAC name is triethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane.
| Compound Name | triethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 22600765 |
| Molecular Formula | C12H19F9O3Si |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | triethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C12H19F9O3Si/c1-4-22-25(23-5-2,24-6-3)8-7-9(13,14)10(15,16)11(17,18)12(19,20)21/h4-8H2,1-3H3 |
| InChIKey | NYIKUOULKCEZDO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|