C11H2F10N2 — CID 22600923
5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(trifluoromethyl)cyclopenta-1,3-diene-1,2-dicarbonitrile (PubChem CID 22600923) has the molecular formula C11H2F10N2 and a molecular weight of 352.13 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(trifluoromethyl)cyclopenta-1,3-diene-1,2-dicarbonitrile.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(trifluoromethyl)cyclopenta-1,3-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 22600923 |
| Molecular Formula | C11H2F10N2 |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(trifluoromethyl)cyclopenta-1,3-diene-1,2-dicarbonitrile |
| SMILES | N#CC1=C(C#N)C(C(F)(F)C(F)(F)C(F)(F)F)C=C1C(F)(F)F |
| InChI | InChI=1S/C11H2F10N2/c12-8(13,10(17,18)11(19,20)21)6-1-7(9(14,15)16)5(3-23)4(6)2-22/h1,6H |
| InChIKey | MIBHAZARHDDSQK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|