C21H36N6O4S2 — CID 22600926
4,5-dicyano-1-N,2-N-bis(2-ethylhexyl)imidazole-1,2-disulfonamide (PubChem CID 22600926) has the molecular formula C21H36N6O4S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 4,5-dicyano-1-N,2-N-bis(2-ethylhexyl)imidazole-1,2-disulfonamide.
| Compound Name | 4,5-dicyano-1-N,2-N-bis(2-ethylhexyl)imidazole-1,2-disulfonamide |
|---|---|
| PubChem CID | 22600926 |
| Molecular Formula | C21H36N6O4S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 4,5-dicyano-1-N,2-N-bis(2-ethylhexyl)imidazole-1,2-disulfonamide |
| SMILES | CCCCC(CC)CNS(=O)(=O)c1nc(C#N)c(C#N)n1S(=O)(=O)NCC(CC)CCCC |
| InChI | InChI=1S/C21H36N6O4S2/c1-5-9-11-17(7-3)15-24-32(28,29)21-26-19(13-22)20(14-23)27(21)33(30,31)25-16-18(8-4)12-10-6-2/h17-18,24-25H,5-12,15-16H2,1-4H3 |
| InChIKey | IXTJUZZKCYAMAS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |