About (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate
(1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate (PubChem CID 22600962) has the molecular formula C11H15F3O2
and a molecular weight of 236.23 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 22600962 |
| Molecular Formula | C11H15F3O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC1(CC)CCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O2/c1-3-10(6-4-5-7-10)16-9(15)8(2)11(12,13)14/h2-7H2,1H3 |
| InChIKey | GUYBYECGVWQJBM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate (CID 22600962) is (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate is C=C(C(=O)OC1(CC)CCCC1)C(F)(F)F.
What is the InChIKey of (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is GUYBYECGVWQJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3O2/c1-3-10(6-4-5-7-10)16-9(15)8(2)11(12,13)14/h2-7H2,1H3.
What are the key properties of (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate?
(1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 236.23 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 22600962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).