C29H25Cl2N5O5S — CID 22601443
3,5-dichloro-N-[[4-[[(2-nitrophenyl)sulfonyl-(5,6,7,8-tetrahydroquinolin-7-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 22601443) has the molecular formula C29H25Cl2N5O5S and a molecular weight of 626.52 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-[[(2-nitrophenyl)sulfonyl-(5,6,7,8-tetrahydroquinolin-7-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3,5-dichloro-N-[[4-[[(2-nitrophenyl)sulfonyl-(5,6,7,8-tetrahydroquinolin-7-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 22601443 |
| Molecular Formula | C29H25Cl2N5O5S |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | 3,5-dichloro-N-[[4-[[(2-nitrophenyl)sulfonyl-(5,6,7,8-tetrahydroquinolin-7-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccc(CN(C2CCc3cccnc3C2)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C29H25Cl2N5O5S/c30-23-16-32-17-24(31)28(23)29(37)34-15-19-7-9-20(10-8-19)18-35(22-12-11-21-4-3-13-33-25(21)14-22)42(40,41)27-6-2-1-5-26(27)36(38)39/h1-10,13,16-17,22H,11-12,14-15,18H2,(H,34,37) |
| InChIKey | HBAVTOXWQVQFRL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|