About S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate
S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (PubChem CID 22601925) has the molecular formula C11H14O2S4
and a molecular weight of 306.50 g/mol. Its IUPAC name is S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
Molecular Properties
| Compound Name | S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| PubChem CID | 22601925 |
| Molecular Formula | C11H14O2S4 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1CSC(CSC(=O)C=C)S1 |
| InChI | InChI=1S/C11H14O2S4/c1-3-9(12)14-5-8-6-16-11(17-8)7-15-10(13)4-2/h3-4,8,11H,1-2,5-7H2 |
| InChIKey | KHENCRQDTGBOLB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate?
The IUPAC name of S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (CID 22601925) is S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
What is the SMILES notation for S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate?
The canonical SMILES for S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate is C=CC(=O)SCC1CSC(CSC(=O)C=C)S1.
What is the InChIKey of S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate?
The InChIKey is KHENCRQDTGBOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S4/c1-3-9(12)14-5-8-6-16-11(17-8)7-15-10(13)4-2/h3-4,8,11H,1-2,5-7H2.
What are the key properties of S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate?
S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate has a molecular weight of 306.50 g/mol, XLogP of 3.05, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[[2-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate is sourced from PubChem (CID 22601925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).