About 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine
4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine (PubChem CID 22602085) has the molecular formula C12H9Cl6N3O
and a molecular weight of 423.94 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine |
| PubChem CID | 22602085 |
| Molecular Formula | C12H9Cl6N3O |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 420.89 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine |
| SMILES | COc1ccc(C2=NN(C(Cl)(Cl)Cl)NC(C(Cl)(Cl)Cl)=C2)cc1 |
| InChI | InChI=1S/C12H9Cl6N3O/c1-22-8-4-2-7(3-5-8)9-6-10(11(13,14)15)20-21(19-9)12(16,17)18/h2-6,20H,1H3 |
| InChIKey | PYZLGPXVMQPBBP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine?
The IUPAC name of 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine (CID 22602085) is 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine.
What is the SMILES notation for 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine?
The canonical SMILES for 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine is COc1ccc(C2=NN(C(Cl)(Cl)Cl)NC(C(Cl)(Cl)Cl)=C2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine?
The InChIKey is PYZLGPXVMQPBBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl6N3O/c1-22-8-4-2-7(3-5-8)9-6-10(11(13,14)15)20-21(19-9)12(16,17)18/h2-6,20H,1H3.
What are the key properties of 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine?
4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine has a molecular weight of 423.94 g/mol, XLogP of 4.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2,6-bis(trichloromethyl)-1H-triazine is sourced from PubChem (CID 22602085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).