C22H34O2S8 — CID 22602108
S-[[2-[6-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]hexylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (PubChem CID 22602108) has the molecular formula C22H34O2S8 and a molecular weight of 587.05 g/mol. Its IUPAC name is S-[[2-[6-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]hexylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
| Compound Name | S-[[2-[6-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]hexylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
|---|---|
| PubChem CID | 22602108 |
| Molecular Formula | C22H34O2S8 |
| Molecular Weight | 587.05 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | S-[[2-[6-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]hexylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1CSC(CSCCCCCCSCC2SCC(CSC(=O)C=C)S2)S1 |
| InChI | InChI=1S/C22H34O2S8/c1-3-19(23)27-11-17-13-29-21(31-17)15-25-9-7-5-6-8-10-26-16-22-30-14-18(32-22)12-28-20(24)4-2/h3-4,17-18,21-22H,1-2,5-16H2 |
| InChIKey | AWOYHGMIBFSEKE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.05 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|