C17H24O2S8 — CID 22602178
S-[[2-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (PubChem CID 22602178) has the molecular formula C17H24O2S8 and a molecular weight of 516.91 g/mol. Its IUPAC name is S-[[2-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
| Compound Name | S-[[2-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
|---|---|
| PubChem CID | 22602178 |
| Molecular Formula | C17H24O2S8 |
| Molecular Weight | 516.91 g/mol |
| Exact Mass | 515.95 |
| IUPAC Name | S-[[2-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1CSC(CSCSCC2SCC(CSC(=O)C=C)S2)S1 |
| InChI | InChI=1S/C17H24O2S8/c1-3-14(18)22-5-12-7-24-16(26-12)9-20-11-21-10-17-25-8-13(27-17)6-23-15(19)4-2/h3-4,12-13,16-17H,1-2,5-11H2 |
| InChIKey | WBDJFIFVKIPMKC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.91 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|