C19H28O2S8 — CID 22602216
S-[[2-[1-[1-[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]ethylsulfanylmethylsulfanyl]ethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (PubChem CID 22602216) has the molecular formula C19H28O2S8 and a molecular weight of 544.97 g/mol. Its IUPAC name is S-[[2-[1-[1-[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]ethylsulfanylmethylsulfanyl]ethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
| Compound Name | S-[[2-[1-[1-[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]ethylsulfanylmethylsulfanyl]ethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
|---|---|
| PubChem CID | 22602216 |
| Molecular Formula | C19H28O2S8 |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 543.99 |
| IUPAC Name | S-[[2-[1-[1-[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]ethylsulfanylmethylsulfanyl]ethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1CSC(C(C)SCSC(C)C2SCC(CSC(=O)C=C)S2)S1 |
| InChI | InChI=1S/C19H28O2S8/c1-5-16(20)22-7-14-9-24-18(28-14)12(3)26-11-27-13(4)19-25-10-15(29-19)8-23-17(21)6-2/h5-6,12-15,18-19H,1-2,7-11H2,3-4H3 |
| InChIKey | VPFIGRCELVWSDP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|