C21H32O2S8 — CID 22602219
S-[[2-[5-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]pentylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (PubChem CID 22602219) has the molecular formula C21H32O2S8 and a molecular weight of 573.02 g/mol. Its IUPAC name is S-[[2-[5-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]pentylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
| Compound Name | S-[[2-[5-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]pentylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
|---|---|
| PubChem CID | 22602219 |
| Molecular Formula | C21H32O2S8 |
| Molecular Weight | 573.02 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | S-[[2-[5-[[4-(prop-2-enoylsulfanylmethyl)-1,3-dithiolan-2-yl]methylsulfanyl]pentylsulfanylmethyl]-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1CSC(CSCCCCCSCC2SCC(CSC(=O)C=C)S2)S1 |
| InChI | InChI=1S/C21H32O2S8/c1-3-18(22)26-10-16-12-28-20(30-16)14-24-8-6-5-7-9-25-15-21-29-13-17(31-21)11-27-19(23)4-2/h3-4,16-17,20-21H,1-2,5-15H2 |
| InChIKey | RFQWMGGNOCORQZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.02 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|